C8H4BrNO2S2 — CID 106510216
2-bromo-5-thiophen-2-yl-1,3-thiazole-4-carboxylic acid (PubChem CID 106510216) has the molecular formula C8H4BrNO2S2 and a molecular weight of 290.16 g/mol. Its IUPAC name is 2-bromo-5-thiophen-2-yl-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-bromo-5-thiophen-2-yl-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106510216 |
| Molecular Formula | C8H4BrNO2S2 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 288.89 |
| IUPAC Name | 2-bromo-5-thiophen-2-yl-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1nc(Br)sc1-c1cccs1 |
| InChI | InChI=1S/C8H4BrNO2S2/c9-8-10-5(7(11)12)6(14-8)4-2-1-3-13-4/h1-3H,(H,11,12) |
| InChIKey | XOPVYRSTCCJZML-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |