C14H6Br2N2S3 — CID 71722248
2,3-dibromo-5,7-dithiophen-2-ylthieno[3,4-b]pyrazine (PubChem CID 71722248) has the molecular formula C14H6Br2N2S3 and a molecular weight of 458.23 g/mol. Its IUPAC name is 2,3-dibromo-5,7-dithiophen-2-ylthieno[3,4-b]pyrazine.
| Compound Name | 2,3-dibromo-5,7-dithiophen-2-ylthieno[3,4-b]pyrazine |
|---|---|
| PubChem CID | 71722248 |
| Molecular Formula | C14H6Br2N2S3 |
| Molecular Weight | 458.23 g/mol |
| Exact Mass | 455.81 |
| IUPAC Name | 2,3-dibromo-5,7-dithiophen-2-ylthieno[3,4-b]pyrazine |
| SMILES | Brc1nc2c(-c3cccs3)sc(-c3cccs3)c2nc1Br |
| InChI | InChI=1S/C14H6Br2N2S3/c15-13-14(16)18-10-9(17-13)11(7-3-1-5-19-7)21-12(10)8-4-2-6-20-8/h1-6H |
| InChIKey | VGGRBEJPHCJOOY-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.23 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |