C15H11N3OS — CID 62503235
5-(1-benzofuran-2-yl)-4-thiophen-2-yl-1H-pyrazol-3-amine (PubChem CID 62503235) has the molecular formula C15H11N3OS and a molecular weight of 281.34 g/mol. Its IUPAC name is 5-(1-benzofuran-2-yl)-4-thiophen-2-yl-1H-pyrazol-3-amine.
| Compound Name | 5-(1-benzofuran-2-yl)-4-thiophen-2-yl-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 62503235 |
| Molecular Formula | C15H11N3OS |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 5-(1-benzofuran-2-yl)-4-thiophen-2-yl-1H-pyrazol-3-amine |
| SMILES | Nc1n[nH]c(-c2cc3ccccc3o2)c1-c1cccs1 |
| InChI | InChI=1S/C15H11N3OS/c16-15-13(12-6-3-7-20-12)14(17-18-15)11-8-9-4-1-2-5-10(9)19-11/h1-8H,(H3,16,17,18) |
| InChIKey | NANUJURFWIDETG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |