C38H23NO3S2 — CID 141275777
2-[4-(1-benzofuran-2-yl)-2,3-bis(furan-2-yl)-5,6-dithiophen-2-ylphenyl]-1H-indole (PubChem CID 141275777) has the molecular formula C38H23NO3S2 and a molecular weight of 605.74 g/mol. Its IUPAC name is 2-[4-(1-benzofuran-2-yl)-2,3-bis(furan-2-yl)-5,6-dithiophen-2-ylphenyl]-1H-indole.
| Compound Name | 2-[4-(1-benzofuran-2-yl)-2,3-bis(furan-2-yl)-5,6-dithiophen-2-ylphenyl]-1H-indole |
|---|---|
| PubChem CID | 141275777 |
| Molecular Formula | C38H23NO3S2 |
| Molecular Weight | 605.74 g/mol |
| Exact Mass | 605.11 |
| IUPAC Name | 2-[4-(1-benzofuran-2-yl)-2,3-bis(furan-2-yl)-5,6-dithiophen-2-ylphenyl]-1H-indole |
| SMILES | c1coc(-c2c(-c3cc4ccccc4[nH]3)c(-c3cccs3)c(-c3cccs3)c(-c3cc4ccccc4o3)c2-c2ccco2)c1 |
| InChI | InChI=1S/C38H23NO3S2/c1-3-11-25-23(9-1)21-26(39-25)33-34(28-13-5-17-40-28)35(29-14-6-18-41-29)36(30-22-24-10-2-4-12-27(24)42-30)38(32-16-8-20-44-32)37(33)31-15-7-19-43-31/h1-22,39H |
| InChIKey | XHXCZMTVVLCQRY-UHFFFAOYSA-N |
| XLogP | 12.23 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.74 |
| LogP ≤ 5 | 12.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |