C13H9F2N3S — CID 61496475
4-(3,5-difluorophenyl)-5-thiophen-2-yl-1H-pyrazol-3-amine (PubChem CID 61496475) has the molecular formula C13H9F2N3S and a molecular weight of 277.30 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)-5-thiophen-2-yl-1H-pyrazol-3-amine.
| Compound Name | 4-(3,5-difluorophenyl)-5-thiophen-2-yl-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 61496475 |
| Molecular Formula | C13H9F2N3S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 4-(3,5-difluorophenyl)-5-thiophen-2-yl-1H-pyrazol-3-amine |
| SMILES | Nc1n[nH]c(-c2cccs2)c1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H9F2N3S/c14-8-4-7(5-9(15)6-8)11-12(17-18-13(11)16)10-2-1-3-19-10/h1-6H,(H3,16,17,18) |
| InChIKey | RYEMEXPDRPYZEI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |