C13H9ClFN3S — CID 43334983
4-(2-chloro-6-fluorophenyl)-5-thiophen-2-yl-1H-pyrazol-3-amine (PubChem CID 43334983) has the molecular formula C13H9ClFN3S and a molecular weight of 293.75 g/mol. Its IUPAC name is 4-(2-chloro-6-fluorophenyl)-5-thiophen-2-yl-1H-pyrazol-3-amine.
| Compound Name | 4-(2-chloro-6-fluorophenyl)-5-thiophen-2-yl-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 43334983 |
| Molecular Formula | C13H9ClFN3S |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 4-(2-chloro-6-fluorophenyl)-5-thiophen-2-yl-1H-pyrazol-3-amine |
| SMILES | Nc1n[nH]c(-c2cccs2)c1-c1c(F)cccc1Cl |
| InChI | InChI=1S/C13H9ClFN3S/c14-7-3-1-4-8(15)10(7)11-12(17-18-13(11)16)9-5-2-6-19-9/h1-6H,(H3,16,17,18) |
| InChIKey | FVLYQCKOMSYKPQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |