C15H11ClFN3OS — CID 156585238
2-chloro-6-fluoro-N-(4-methyl-5-thiophen-2-yl-1H-pyrazol-3-yl)benzamide (PubChem CID 156585238) has the molecular formula C15H11ClFN3OS and a molecular weight of 335.79 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N-(4-methyl-5-thiophen-2-yl-1H-pyrazol-3-yl)benzamide.
| Compound Name | 2-chloro-6-fluoro-N-(4-methyl-5-thiophen-2-yl-1H-pyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 156585238 |
| Molecular Formula | C15H11ClFN3OS |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 2-chloro-6-fluoro-N-(4-methyl-5-thiophen-2-yl-1H-pyrazol-3-yl)benzamide |
| SMILES | Cc1c(NC(=O)c2c(F)cccc2Cl)n[nH]c1-c1cccs1 |
| InChI | InChI=1S/C15H11ClFN3OS/c1-8-13(11-6-3-7-22-11)19-20-14(8)18-15(21)12-9(16)4-2-5-10(12)17/h2-7H,1H3,(H2,18,19,20,21) |
| InChIKey | OSJSNMMTNZAHQA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |