C10H6Cl2FN3OS — CID 93205844
2-chloro-N-[5-(chloromethyl)-1,3,4-thiadiazol-2-yl]-6-fluorobenzamide (PubChem CID 93205844) has the molecular formula C10H6Cl2FN3OS and a molecular weight of 306.15 g/mol. Its IUPAC name is 2-chloro-N-[5-(chloromethyl)-1,3,4-thiadiazol-2-yl]-6-fluorobenzamide.
| Compound Name | 2-chloro-N-[5-(chloromethyl)-1,3,4-thiadiazol-2-yl]-6-fluorobenzamide |
|---|---|
| PubChem CID | 93205844 |
| Molecular Formula | C10H6Cl2FN3OS |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 304.96 |
| IUPAC Name | 2-chloro-N-[5-(chloromethyl)-1,3,4-thiadiazol-2-yl]-6-fluorobenzamide |
| SMILES | O=C(Nc1nnc(CCl)s1)c1c(F)cccc1Cl |
| InChI | InChI=1S/C10H6Cl2FN3OS/c11-4-7-15-16-10(18-7)14-9(17)8-5(12)2-1-3-6(8)13/h1-3H,4H2,(H,14,16,17) |
| InChIKey | RWZVRRAEETZWLP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|