C17H12ClFN2OS — CID 51152768
N-(5-benzyl-1,3-thiazol-2-yl)-2-chloro-6-fluorobenzamide (PubChem CID 51152768) has the molecular formula C17H12ClFN2OS and a molecular weight of 346.81 g/mol. Its IUPAC name is N-(5-benzyl-1,3-thiazol-2-yl)-2-chloro-6-fluorobenzamide.
| Compound Name | N-(5-benzyl-1,3-thiazol-2-yl)-2-chloro-6-fluorobenzamide |
|---|---|
| PubChem CID | 51152768 |
| Molecular Formula | C17H12ClFN2OS |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | N-(5-benzyl-1,3-thiazol-2-yl)-2-chloro-6-fluorobenzamide |
| SMILES | O=C(Nc1ncc(Cc2ccccc2)s1)c1c(F)cccc1Cl |
| InChI | InChI=1S/C17H12ClFN2OS/c18-13-7-4-8-14(19)15(13)16(22)21-17-20-10-12(23-17)9-11-5-2-1-3-6-11/h1-8,10H,9H2,(H,20,21,22) |
| InChIKey | RCJMVEATRDADKT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |