C13H13F2N3O — CID 155945536
N-(5-ethyl-4-methyl-1H-pyrazol-3-yl)-2,6-difluorobenzamide (PubChem CID 155945536) has the molecular formula C13H13F2N3O and a molecular weight of 265.26 g/mol. Its IUPAC name is N-(5-ethyl-4-methyl-1H-pyrazol-3-yl)-2,6-difluorobenzamide.
| Compound Name | N-(5-ethyl-4-methyl-1H-pyrazol-3-yl)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 155945536 |
| Molecular Formula | C13H13F2N3O |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | N-(5-ethyl-4-methyl-1H-pyrazol-3-yl)-2,6-difluorobenzamide |
| SMILES | CCc1[nH]nc(NC(=O)c2c(F)cccc2F)c1C |
| InChI | InChI=1S/C13H13F2N3O/c1-3-10-7(2)12(18-17-10)16-13(19)11-8(14)5-4-6-9(11)15/h4-6H,3H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | BYCSYQGJISMKKR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |