C12H8F5N3O — CID 104620121
N-(4,5-dimethyl-1H-pyrazol-3-yl)-2,3,4,5,6-pentafluorobenzamide (PubChem CID 104620121) has the molecular formula C12H8F5N3O and a molecular weight of 305.21 g/mol. Its IUPAC name is N-(4,5-dimethyl-1H-pyrazol-3-yl)-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-(4,5-dimethyl-1H-pyrazol-3-yl)-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 104620121 |
| Molecular Formula | C12H8F5N3O |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | N-(4,5-dimethyl-1H-pyrazol-3-yl)-2,3,4,5,6-pentafluorobenzamide |
| SMILES | Cc1[nH]nc(NC(=O)c2c(F)c(F)c(F)c(F)c2F)c1C |
| InChI | InChI=1S/C12H8F5N3O/c1-3-4(2)19-20-11(3)18-12(21)5-6(13)8(15)10(17)9(16)7(5)14/h1-2H3,(H2,18,19,20,21) |
| InChIKey | LBYZWYWBUNHQRU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|