About 4-chloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-2,5-difluorobenzamide
4-chloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-2,5-difluorobenzamide (PubChem CID 112547954) has the molecular formula C12H10ClF2N3O
and a molecular weight of 285.68 g/mol. Its IUPAC name is 4-chloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-2,5-difluorobenzamide.
Molecular Properties
| Compound Name | 4-chloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-2,5-difluorobenzamide |
| PubChem CID | 112547954 |
| Molecular Formula | C12H10ClF2N3O |
| Molecular Weight | 285.68 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 4-chloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-2,5-difluorobenzamide |
| SMILES | Cc1[nH]nc(NC(=O)c2cc(F)c(Cl)cc2F)c1C |
| InChI | InChI=1S/C12H10ClF2N3O/c1-5-6(2)17-18-11(5)16-12(19)7-3-10(15)8(13)4-9(7)14/h3-4H,1-2H3,(H2,16,17,18,19) |
| InChIKey | BGVNTWRCBXOOBJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.68 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-2,5-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-2,5-difluorobenzamide?
The IUPAC name of 4-chloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-2,5-difluorobenzamide (CID 112547954) is 4-chloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-2,5-difluorobenzamide.
What is the SMILES notation for 4-chloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-2,5-difluorobenzamide?
The canonical SMILES for 4-chloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-2,5-difluorobenzamide is Cc1[nH]nc(NC(=O)c2cc(F)c(Cl)cc2F)c1C.
What is the InChIKey of 4-chloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-2,5-difluorobenzamide?
The InChIKey is BGVNTWRCBXOOBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClF2N3O/c1-5-6(2)17-18-11(5)16-12(19)7-3-10(15)8(13)4-9(7)14/h3-4H,1-2H3,(H2,16,17,18,19).
What are the key properties of 4-chloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-2,5-difluorobenzamide?
4-chloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-2,5-difluorobenzamide has a molecular weight of 285.68 g/mol, XLogP of 3.21, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-2,5-difluorobenzamide is sourced from PubChem (CID 112547954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).