C11H9ClF2N4O — CID 82781958
N-(4-amino-5-methyl-1H-pyrazol-3-yl)-4-chloro-2,5-difluorobenzamide (PubChem CID 82781958) has the molecular formula C11H9ClF2N4O and a molecular weight of 286.67 g/mol. Its IUPAC name is N-(4-amino-5-methyl-1H-pyrazol-3-yl)-4-chloro-2,5-difluorobenzamide.
| Compound Name | N-(4-amino-5-methyl-1H-pyrazol-3-yl)-4-chloro-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 82781958 |
| Molecular Formula | C11H9ClF2N4O |
| Molecular Weight | 286.67 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | N-(4-amino-5-methyl-1H-pyrazol-3-yl)-4-chloro-2,5-difluorobenzamide |
| SMILES | Cc1[nH]nc(NC(=O)c2cc(F)c(Cl)cc2F)c1N |
| InChI | InChI=1S/C11H9ClF2N4O/c1-4-9(15)10(18-17-4)16-11(19)5-2-8(14)6(12)3-7(5)13/h2-3H,15H2,1H3,(H2,16,17,18,19) |
| InChIKey | QVNMOQAWJVMFKW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.67 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|