C13H13Cl2N3O2 — CID 154805189
4,5-dichloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-2-methoxybenzamide (PubChem CID 154805189) has the molecular formula C13H13Cl2N3O2 and a molecular weight of 314.17 g/mol. Its IUPAC name is 4,5-dichloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-2-methoxybenzamide.
| Compound Name | 4,5-dichloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-2-methoxybenzamide |
|---|---|
| PubChem CID | 154805189 |
| Molecular Formula | C13H13Cl2N3O2 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 4,5-dichloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-2-methoxybenzamide |
| SMILES | COc1cc(Cl)c(Cl)cc1C(=O)Nc1n[nH]c(C)c1C |
| InChI | InChI=1S/C13H13Cl2N3O2/c1-6-7(2)17-18-12(6)16-13(19)8-4-9(14)10(15)5-11(8)20-3/h4-5H,1-3H3,(H2,16,17,18,19) |
| InChIKey | ZJSWMHJUOIRPGT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |