C14H17N3O — CID 112687360
N-(4,5-dimethyl-1H-pyrazol-3-yl)-3,4-dimethylbenzamide (PubChem CID 112687360) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is N-(4,5-dimethyl-1H-pyrazol-3-yl)-3,4-dimethylbenzamide.
| Compound Name | N-(4,5-dimethyl-1H-pyrazol-3-yl)-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 112687360 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | N-(4,5-dimethyl-1H-pyrazol-3-yl)-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2n[nH]c(C)c2C)cc1C |
| InChI | InChI=1S/C14H17N3O/c1-8-5-6-12(7-9(8)2)14(18)15-13-10(3)11(4)16-17-13/h5-7H,1-4H3,(H2,15,16,17,18) |
| InChIKey | IMFWXOFDYQPNEW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |