C13H15N3O3S — CID 115594880
N-(4,5-dimethyl-1H-pyrazol-3-yl)-3-methylsulfonylbenzamide (PubChem CID 115594880) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is N-(4,5-dimethyl-1H-pyrazol-3-yl)-3-methylsulfonylbenzamide.
| Compound Name | N-(4,5-dimethyl-1H-pyrazol-3-yl)-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 115594880 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-(4,5-dimethyl-1H-pyrazol-3-yl)-3-methylsulfonylbenzamide |
| SMILES | Cc1[nH]nc(NC(=O)c2cccc(S(C)(=O)=O)c2)c1C |
| InChI | InChI=1S/C13H15N3O3S/c1-8-9(2)15-16-12(8)14-13(17)10-5-4-6-11(7-10)20(3,18)19/h4-7H,1-3H3,(H2,14,15,16,17) |
| InChIKey | OFNPJFZUDWLSLY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |