C12H13N3O3S — CID 112691143
N-(4-methyl-1H-pyrazol-5-yl)-3-methylsulfonylbenzamide (PubChem CID 112691143) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is N-(4-methyl-1H-pyrazol-5-yl)-3-methylsulfonylbenzamide.
| Compound Name | N-(4-methyl-1H-pyrazol-5-yl)-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 112691143 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | N-(4-methyl-1H-pyrazol-5-yl)-3-methylsulfonylbenzamide |
| SMILES | Cc1cn[nH]c1NC(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C12H13N3O3S/c1-8-7-13-15-11(8)14-12(16)9-4-3-5-10(6-9)19(2,17)18/h3-7H,1-2H3,(H2,13,14,15,16) |
| InChIKey | LOTSEZJPWYOVPR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |