C12H10Cl2FN3O — CID 115609989
2,4-dichloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-5-fluorobenzamide (PubChem CID 115609989) has the molecular formula C12H10Cl2FN3O and a molecular weight of 302.14 g/mol. Its IUPAC name is 2,4-dichloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-5-fluorobenzamide.
| Compound Name | 2,4-dichloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-5-fluorobenzamide |
|---|---|
| PubChem CID | 115609989 |
| Molecular Formula | C12H10Cl2FN3O |
| Molecular Weight | 302.14 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 2,4-dichloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-5-fluorobenzamide |
| SMILES | Cc1[nH]nc(NC(=O)c2cc(F)c(Cl)cc2Cl)c1C |
| InChI | InChI=1S/C12H10Cl2FN3O/c1-5-6(2)17-18-11(5)16-12(19)7-3-10(15)9(14)4-8(7)13/h3-4H,1-2H3,(H2,16,17,18,19) |
| InChIKey | SAKLRIDWCOOYSA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.14 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|