C12H12F2N4O — CID 104616474
2-amino-N-(4,5-dimethyl-1H-pyrazol-3-yl)-4,5-difluorobenzamide (PubChem CID 104616474) has the molecular formula C12H12F2N4O and a molecular weight of 266.25 g/mol. Its IUPAC name is 2-amino-N-(4,5-dimethyl-1H-pyrazol-3-yl)-4,5-difluorobenzamide.
| Compound Name | 2-amino-N-(4,5-dimethyl-1H-pyrazol-3-yl)-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 104616474 |
| Molecular Formula | C12H12F2N4O |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 2-amino-N-(4,5-dimethyl-1H-pyrazol-3-yl)-4,5-difluorobenzamide |
| SMILES | Cc1[nH]nc(NC(=O)c2cc(F)c(F)cc2N)c1C |
| InChI | InChI=1S/C12H12F2N4O/c1-5-6(2)17-18-11(5)16-12(19)7-3-8(13)9(14)4-10(7)15/h3-4H,15H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | IKZQFXCEUQQZLA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|