C7H10ClN3O — CID 104617747
2-chloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)acetamide (PubChem CID 104617747) has the molecular formula C7H10ClN3O and a molecular weight of 187.63 g/mol. Its IUPAC name is 2-chloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)acetamide.
| Compound Name | 2-chloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 104617747 |
| Molecular Formula | C7H10ClN3O |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 2-chloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)acetamide |
| SMILES | Cc1[nH]nc(NC(=O)CCl)c1C |
| InChI | InChI=1S/C7H10ClN3O/c1-4-5(2)10-11-7(4)9-6(12)3-8/h3H2,1-2H3,(H2,9,10,11,12) |
| InChIKey | PLMQBBXAXZKKSG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|