C10H18N4O — CID 104618770
N-(4,5-dimethyl-1H-pyrazol-3-yl)-3-(ethylamino)propanamide (PubChem CID 104618770) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is N-(4,5-dimethyl-1H-pyrazol-3-yl)-3-(ethylamino)propanamide.
| Compound Name | N-(4,5-dimethyl-1H-pyrazol-3-yl)-3-(ethylamino)propanamide |
|---|---|
| PubChem CID | 104618770 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | N-(4,5-dimethyl-1H-pyrazol-3-yl)-3-(ethylamino)propanamide |
| SMILES | CCNCCC(=O)Nc1n[nH]c(C)c1C |
| InChI | InChI=1S/C10H18N4O/c1-4-11-6-5-9(15)12-10-7(2)8(3)13-14-10/h11H,4-6H2,1-3H3,(H2,12,13,14,15) |
| InChIKey | GQQHPASJVYXYTG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|