About 6-amino-N-(4,5-dimethyl-1H-pyrazol-3-yl)-4,4-dimethylhexanamide
6-amino-N-(4,5-dimethyl-1H-pyrazol-3-yl)-4,4-dimethylhexanamide (PubChem CID 104618745) has the molecular formula C13H24N4O
and a molecular weight of 252.36 g/mol. Its IUPAC name is 6-amino-N-(4,5-dimethyl-1H-pyrazol-3-yl)-4,4-dimethylhexanamide.
Molecular Properties
| Compound Name | 6-amino-N-(4,5-dimethyl-1H-pyrazol-3-yl)-4,4-dimethylhexanamide |
| PubChem CID | 104618745 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 6-amino-N-(4,5-dimethyl-1H-pyrazol-3-yl)-4,4-dimethylhexanamide |
| SMILES | Cc1[nH]nc(NC(=O)CCC(C)(C)CCN)c1C |
| InChI | InChI=1S/C13H24N4O/c1-9-10(2)16-17-12(9)15-11(18)5-6-13(3,4)7-8-14/h5-8,14H2,1-4H3,(H2,15,16,17,18) |
| InChIKey | SXLGUCKQHUARMB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-N-(4,5-dimethyl-1H-pyrazol-3-yl)-4,4-dimethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-N-(4,5-dimethyl-1H-pyrazol-3-yl)-4,4-dimethylhexanamide?
The IUPAC name of 6-amino-N-(4,5-dimethyl-1H-pyrazol-3-yl)-4,4-dimethylhexanamide (CID 104618745) is 6-amino-N-(4,5-dimethyl-1H-pyrazol-3-yl)-4,4-dimethylhexanamide.
What is the SMILES notation for 6-amino-N-(4,5-dimethyl-1H-pyrazol-3-yl)-4,4-dimethylhexanamide?
The canonical SMILES for 6-amino-N-(4,5-dimethyl-1H-pyrazol-3-yl)-4,4-dimethylhexanamide is Cc1[nH]nc(NC(=O)CCC(C)(C)CCN)c1C.
What is the InChIKey of 6-amino-N-(4,5-dimethyl-1H-pyrazol-3-yl)-4,4-dimethylhexanamide?
The InChIKey is SXLGUCKQHUARMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N4O/c1-9-10(2)16-17-12(9)15-11(18)5-6-13(3,4)7-8-14/h5-8,14H2,1-4H3,(H2,15,16,17,18).
What are the key properties of 6-amino-N-(4,5-dimethyl-1H-pyrazol-3-yl)-4,4-dimethylhexanamide?
6-amino-N-(4,5-dimethyl-1H-pyrazol-3-yl)-4,4-dimethylhexanamide has a molecular weight of 252.36 g/mol, XLogP of 2.12, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-N-(4,5-dimethyl-1H-pyrazol-3-yl)-4,4-dimethylhexanamide is sourced from PubChem (CID 104618745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).