About 6-amino-4,4-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)hexanamide
6-amino-4,4-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)hexanamide (PubChem CID 116786923) has the molecular formula C12H20N4O2
and a molecular weight of 252.32 g/mol. Its IUPAC name is 6-amino-4,4-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)hexanamide.
Molecular Properties
| Compound Name | 6-amino-4,4-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)hexanamide |
| PubChem CID | 116786923 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 6-amino-4,4-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)hexanamide |
| SMILES | CC(C)(CCN)CCC(=O)Nc1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C12H20N4O2/c1-12(2,7-8-13)6-5-10(17)14-9-3-4-11(18)16-15-9/h3-4H,5-8,13H2,1-2H3,(H,16,18)(H,14,15,17) |
| InChIKey | OICGCFQPCMDCLS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-amino-4,4-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-4,4-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)hexanamide?
The IUPAC name of 6-amino-4,4-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)hexanamide (CID 116786923) is 6-amino-4,4-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)hexanamide.
What is the SMILES notation for 6-amino-4,4-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)hexanamide?
The canonical SMILES for 6-amino-4,4-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)hexanamide is CC(C)(CCN)CCC(=O)Nc1ccc(=O)[nH]n1.
What is the InChIKey of 6-amino-4,4-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)hexanamide?
The InChIKey is OICGCFQPCMDCLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O2/c1-12(2,7-8-13)6-5-10(17)14-9-3-4-11(18)16-15-9/h3-4H,5-8,13H2,1-2H3,(H,16,18)(H,14,15,17).
What are the key properties of 6-amino-4,4-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)hexanamide?
6-amino-4,4-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)hexanamide has a molecular weight of 252.32 g/mol, XLogP of 0.86, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-4,4-dimethyl-N-(6-oxo-1H-pyridazin-3-yl)hexanamide is sourced from PubChem (CID 116786923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).