C9H11N3O4 — CID 116787450
2,2-dimethyl-3-oxo-3-[(6-oxo-1H-pyridazin-3-yl)amino]propanoic acid (PubChem CID 116787450) has the molecular formula C9H11N3O4 and a molecular weight of 225.20 g/mol. Its IUPAC name is 2,2-dimethyl-3-oxo-3-[(6-oxo-1H-pyridazin-3-yl)amino]propanoic acid.
| Compound Name | 2,2-dimethyl-3-oxo-3-[(6-oxo-1H-pyridazin-3-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 116787450 |
| Molecular Formula | C9H11N3O4 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 2,2-dimethyl-3-oxo-3-[(6-oxo-1H-pyridazin-3-yl)amino]propanoic acid |
| SMILES | CC(C)(C(=O)O)C(=O)Nc1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C9H11N3O4/c1-9(2,8(15)16)7(14)10-5-3-4-6(13)12-11-5/h3-4H,1-2H3,(H,12,13)(H,15,16)(H,10,11,14) |
| InChIKey | JKBGDHMVHDOSTK-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|