C9H14N4O2 — CID 108887248
1-tert-butyl-3-(6-oxo-1H-pyridazin-3-yl)urea (PubChem CID 108887248) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is 1-tert-butyl-3-(6-oxo-1H-pyridazin-3-yl)urea.
| Compound Name | 1-tert-butyl-3-(6-oxo-1H-pyridazin-3-yl)urea |
|---|---|
| PubChem CID | 108887248 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 1-tert-butyl-3-(6-oxo-1H-pyridazin-3-yl)urea |
| SMILES | CC(C)(C)NC(=O)Nc1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C9H14N4O2/c1-9(2,3)11-8(15)10-6-4-5-7(14)13-12-6/h4-5H,1-3H3,(H,13,14)(H2,10,11,12,15) |
| InChIKey | ALKHWZBUVRDTFJ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |