C11H11N5O2 — CID 108887379
1-(6-methyl-2-pyridinyl)-3-(6-oxo-1H-pyridazin-3-yl)urea (PubChem CID 108887379) has the molecular formula C11H11N5O2 and a molecular weight of 245.24 g/mol. Its IUPAC name is 1-(6-methyl-2-pyridinyl)-3-(6-oxo-1H-pyridazin-3-yl)urea.
| Compound Name | 1-(6-methyl-2-pyridinyl)-3-(6-oxo-1H-pyridazin-3-yl)urea |
|---|---|
| PubChem CID | 108887379 |
| Molecular Formula | C11H11N5O2 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 1-(6-methyl-2-pyridinyl)-3-(6-oxo-1H-pyridazin-3-yl)urea |
| SMILES | Cc1cccc(NC(=O)Nc2ccc(=O)[nH]n2)n1 |
| InChI | InChI=1S/C11H11N5O2/c1-7-3-2-4-8(12-7)13-11(18)14-9-5-6-10(17)16-15-9/h2-6H,1H3,(H,16,17)(H2,12,13,14,15,18) |
| InChIKey | YFVWTOBSYNNQBC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |