C13H14N4O4 — CID 108887187
1-(3,4-dimethoxyphenyl)-3-(6-oxo-1H-pyridazin-3-yl)urea (PubChem CID 108887187) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-(6-oxo-1H-pyridazin-3-yl)urea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-(6-oxo-1H-pyridazin-3-yl)urea |
|---|---|
| PubChem CID | 108887187 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-(6-oxo-1H-pyridazin-3-yl)urea |
| SMILES | COc1ccc(NC(=O)Nc2ccc(=O)[nH]n2)cc1OC |
| InChI | InChI=1S/C13H14N4O4/c1-20-9-4-3-8(7-10(9)21-2)14-13(19)15-11-5-6-12(18)17-16-11/h3-7H,1-2H3,(H,17,18)(H2,14,15,16,19) |
| InChIKey | PARVENLHYJNNRO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |