C16H15N3O3S — CID 108866232
[4-[(3,4-dimethoxyphenyl)carbamoylamino]phenyl] thiocyanate (PubChem CID 108866232) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is [4-[(3,4-dimethoxyphenyl)carbamoylamino]phenyl] thiocyanate.
| Compound Name | [4-[(3,4-dimethoxyphenyl)carbamoylamino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 108866232 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | [4-[(3,4-dimethoxyphenyl)carbamoylamino]phenyl] thiocyanate |
| SMILES | COc1ccc(NC(=O)Nc2ccc(SC#N)cc2)cc1OC |
| InChI | InChI=1S/C16H15N3O3S/c1-21-14-8-5-12(9-15(14)22-2)19-16(20)18-11-3-6-13(7-4-11)23-10-17/h3-9H,1-2H3,(H2,18,19,20) |
| InChIKey | TUTPVGZNSMFGIQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|