C8H10N4O2 — CID 108887387
1-(6-oxo-1H-pyridazin-3-yl)-3-prop-2-enylurea (PubChem CID 108887387) has the molecular formula C8H10N4O2 and a molecular weight of 194.19 g/mol. Its IUPAC name is 1-(6-oxo-1H-pyridazin-3-yl)-3-prop-2-enylurea.
| Compound Name | 1-(6-oxo-1H-pyridazin-3-yl)-3-prop-2-enylurea |
|---|---|
| PubChem CID | 108887387 |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 1-(6-oxo-1H-pyridazin-3-yl)-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)Nc1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C8H10N4O2/c1-2-5-9-8(14)10-6-3-4-7(13)12-11-6/h2-4H,1,5H2,(H,12,13)(H2,9,10,11,14) |
| InChIKey | BVFCWVUJGLVHBE-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|