C13H15N3OS — CID 57132625
1-(3-ethylthieno[3,2-b]pyridin-5-yl)-3-prop-2-enylurea (PubChem CID 57132625) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 1-(3-ethylthieno[3,2-b]pyridin-5-yl)-3-prop-2-enylurea.
| Compound Name | 1-(3-ethylthieno[3,2-b]pyridin-5-yl)-3-prop-2-enylurea |
|---|---|
| PubChem CID | 57132625 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 1-(3-ethylthieno[3,2-b]pyridin-5-yl)-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)Nc1ccc2scc(CC)c2n1 |
| InChI | InChI=1S/C13H15N3OS/c1-3-7-14-13(17)16-11-6-5-10-12(15-11)9(4-2)8-18-10/h3,5-6,8H,1,4,7H2,2H3,(H2,14,15,16,17) |
| InChIKey | ULYSEFVXJRJFBS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|