C10H14N4O2 — CID 108887313
N-(6-oxo-1H-pyridazin-3-yl)piperidine-1-carboxamide (PubChem CID 108887313) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is N-(6-oxo-1H-pyridazin-3-yl)piperidine-1-carboxamide.
| Compound Name | N-(6-oxo-1H-pyridazin-3-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 108887313 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | N-(6-oxo-1H-pyridazin-3-yl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(=O)[nH]n1)N1CCCCC1 |
| InChI | InChI=1S/C10H14N4O2/c15-9-5-4-8(12-13-9)11-10(16)14-6-2-1-3-7-14/h4-5H,1-3,6-7H2,(H,13,15)(H,11,12,16) |
| InChIKey | UPMLKQUQWVIZIM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |