C24H31N5O4 — CID 67313518
4-[3-(2-cyclohexylethoxy)benzoyl]-N-(6-oxo-1H-pyridazin-3-yl)piperazine-1-carboxamide (PubChem CID 67313518) has the molecular formula C24H31N5O4 and a molecular weight of 453.54 g/mol. Its IUPAC name is 4-[3-(2-cyclohexylethoxy)benzoyl]-N-(6-oxo-1H-pyridazin-3-yl)piperazine-1-carboxamide.
| Compound Name | 4-[3-(2-cyclohexylethoxy)benzoyl]-N-(6-oxo-1H-pyridazin-3-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 67313518 |
| Molecular Formula | C24H31N5O4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 4-[3-(2-cyclohexylethoxy)benzoyl]-N-(6-oxo-1H-pyridazin-3-yl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(=O)[nH]n1)N1CCN(C(=O)c2cccc(OCCC3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C24H31N5O4/c30-22-10-9-21(26-27-22)25-24(32)29-14-12-28(13-15-29)23(31)19-7-4-8-20(17-19)33-16-11-18-5-2-1-3-6-18/h4,7-10,17-18H,1-3,5-6,11-16H2,(H,27,30)(H,25,26,32) |
| InChIKey | QHYZJHPEWPQGNU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 107.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |