C11H18N6O2 — CID 108887317
4-(2-aminoethyl)-N-(6-oxo-1H-pyridazin-3-yl)piperazine-1-carboxamide (PubChem CID 108887317) has the molecular formula C11H18N6O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N-(6-oxo-1H-pyridazin-3-yl)piperazine-1-carboxamide.
| Compound Name | 4-(2-aminoethyl)-N-(6-oxo-1H-pyridazin-3-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 108887317 |
| Molecular Formula | C11H18N6O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 4-(2-aminoethyl)-N-(6-oxo-1H-pyridazin-3-yl)piperazine-1-carboxamide |
| SMILES | NCCN1CCN(C(=O)Nc2ccc(=O)[nH]n2)CC1 |
| InChI | InChI=1S/C11H18N6O2/c12-3-4-16-5-7-17(8-6-16)11(19)13-9-1-2-10(18)15-14-9/h1-2H,3-8,12H2,(H,15,18)(H,13,14,19) |
| InChIKey | XBDIJGMYVNFBRP-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |