C11H15N5O3 — CID 108887466
1-N-(6-oxo-1H-pyridazin-3-yl)piperidine-1,4-dicarboxamide (PubChem CID 108887466) has the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 1-N-(6-oxo-1H-pyridazin-3-yl)piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-(6-oxo-1H-pyridazin-3-yl)piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 108887466 |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 1-N-(6-oxo-1H-pyridazin-3-yl)piperidine-1,4-dicarboxamide |
| SMILES | NC(=O)C1CCN(C(=O)Nc2ccc(=O)[nH]n2)CC1 |
| InChI | InChI=1S/C11H15N5O3/c12-10(18)7-3-5-16(6-4-7)11(19)13-8-1-2-9(17)15-14-8/h1-2,7H,3-6H2,(H2,12,18)(H,15,17)(H,13,14,19) |
| InChIKey | ULHDVGJSGVCVGR-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |