C10H13N5O3 — CID 108887439
4-formyl-N-(6-oxo-1H-pyridazin-3-yl)piperazine-1-carboxamide (PubChem CID 108887439) has the molecular formula C10H13N5O3 and a molecular weight of 251.25 g/mol. Its IUPAC name is 4-formyl-N-(6-oxo-1H-pyridazin-3-yl)piperazine-1-carboxamide.
| Compound Name | 4-formyl-N-(6-oxo-1H-pyridazin-3-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 108887439 |
| Molecular Formula | C10H13N5O3 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 4-formyl-N-(6-oxo-1H-pyridazin-3-yl)piperazine-1-carboxamide |
| SMILES | O=CN1CCN(C(=O)Nc2ccc(=O)[nH]n2)CC1 |
| InChI | InChI=1S/C10H13N5O3/c16-7-14-3-5-15(6-4-14)10(18)11-8-1-2-9(17)13-12-8/h1-2,7H,3-6H2,(H,13,17)(H,11,12,18) |
| InChIKey | DHSZOZPHWPORGZ-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|