C7H9N3O2 — CID 108814101
1-(1,2-oxazol-5-yl)-3-prop-2-enylurea (PubChem CID 108814101) has the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. Its IUPAC name is 1-(1,2-oxazol-5-yl)-3-prop-2-enylurea.
| Compound Name | 1-(1,2-oxazol-5-yl)-3-prop-2-enylurea |
|---|---|
| PubChem CID | 108814101 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 1-(1,2-oxazol-5-yl)-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)Nc1ccno1 |
| InChI | InChI=1S/C7H9N3O2/c1-2-4-8-7(11)10-6-3-5-9-12-6/h2-3,5H,1,4H2,(H2,8,10,11) |
| InChIKey | ZMIYGISHTWHCIM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|