C11H12N6O2 — CID 107377055
5-(ethylamino)-N-(6-oxo-1H-pyridazin-3-yl)pyrazine-2-carboxamide (PubChem CID 107377055) has the molecular formula C11H12N6O2 and a molecular weight of 260.26 g/mol. Its IUPAC name is 5-(ethylamino)-N-(6-oxo-1H-pyridazin-3-yl)pyrazine-2-carboxamide.
| Compound Name | 5-(ethylamino)-N-(6-oxo-1H-pyridazin-3-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107377055 |
| Molecular Formula | C11H12N6O2 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 5-(ethylamino)-N-(6-oxo-1H-pyridazin-3-yl)pyrazine-2-carboxamide |
| SMILES | CCNc1cnc(C(=O)Nc2ccc(=O)[nH]n2)cn1 |
| InChI | InChI=1S/C11H12N6O2/c1-2-12-9-6-13-7(5-14-9)11(19)15-8-3-4-10(18)17-16-8/h3-6H,2H2,1H3,(H,12,14)(H,17,18)(H,15,16,19) |
| InChIKey | IYNHGFCVORTAQW-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |