C13H13IN4O — CID 107374377
5-(ethylamino)-N-(4-iodophenyl)pyrazine-2-carboxamide (PubChem CID 107374377) has the molecular formula C13H13IN4O and a molecular weight of 368.18 g/mol. Its IUPAC name is 5-(ethylamino)-N-(4-iodophenyl)pyrazine-2-carboxamide.
| Compound Name | 5-(ethylamino)-N-(4-iodophenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107374377 |
| Molecular Formula | C13H13IN4O |
| Molecular Weight | 368.18 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | 5-(ethylamino)-N-(4-iodophenyl)pyrazine-2-carboxamide |
| SMILES | CCNc1cnc(C(=O)Nc2ccc(I)cc2)cn1 |
| InChI | InChI=1S/C13H13IN4O/c1-2-15-12-8-16-11(7-17-12)13(19)18-10-5-3-9(14)4-6-10/h3-8H,2H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | HFSZJFWAZOXVFJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.18 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|