About N-[6-(3-acetylphenyl)-1H-indazol-3-yl]-2,6-difluorobenzamide
N-[6-(3-acetylphenyl)-1H-indazol-3-yl]-2,6-difluorobenzamide (PubChem CID 69061980) has the molecular formula C22H15F2N3O2
and a molecular weight of 391.38 g/mol. Its IUPAC name is N-[6-(3-acetylphenyl)-1H-indazol-3-yl]-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | N-[6-(3-acetylphenyl)-1H-indazol-3-yl]-2,6-difluorobenzamide |
| PubChem CID | 69061980 |
| Molecular Formula | C22H15F2N3O2 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | N-[6-(3-acetylphenyl)-1H-indazol-3-yl]-2,6-difluorobenzamide |
| SMILES | CC(=O)c1cccc(-c2ccc3c(NC(=O)c4c(F)cccc4F)n[nH]c3c2)c1 |
| InChI | InChI=1S/C22H15F2N3O2/c1-12(28)13-4-2-5-14(10-13)15-8-9-16-19(11-15)26-27-21(16)25-22(29)20-17(23)6-3-7-18(20)24/h2-11H,1H3,(H2,25,26,27,29) |
| InChIKey | KTJDJHFARXEFNP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[6-(3-acetylphenyl)-1H-indazol-3-yl]-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(3-acetylphenyl)-1H-indazol-3-yl]-2,6-difluorobenzamide?
The IUPAC name of N-[6-(3-acetylphenyl)-1H-indazol-3-yl]-2,6-difluorobenzamide (CID 69061980) is N-[6-(3-acetylphenyl)-1H-indazol-3-yl]-2,6-difluorobenzamide.
What is the SMILES notation for N-[6-(3-acetylphenyl)-1H-indazol-3-yl]-2,6-difluorobenzamide?
The canonical SMILES for N-[6-(3-acetylphenyl)-1H-indazol-3-yl]-2,6-difluorobenzamide is CC(=O)c1cccc(-c2ccc3c(NC(=O)c4c(F)cccc4F)n[nH]c3c2)c1.
What is the InChIKey of N-[6-(3-acetylphenyl)-1H-indazol-3-yl]-2,6-difluorobenzamide?
The InChIKey is KTJDJHFARXEFNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15F2N3O2/c1-12(28)13-4-2-5-14(10-13)15-8-9-16-19(11-15)26-27-21(16)25-22(29)20-17(23)6-3-7-18(20)24/h2-11H,1H3,(H2,25,26,27,29).
What are the key properties of N-[6-(3-acetylphenyl)-1H-indazol-3-yl]-2,6-difluorobenzamide?
N-[6-(3-acetylphenyl)-1H-indazol-3-yl]-2,6-difluorobenzamide has a molecular weight of 391.38 g/mol, XLogP of 4.96, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(3-acetylphenyl)-1H-indazol-3-yl]-2,6-difluorobenzamide is sourced from PubChem (CID 69061980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).