C22H18FN3O3 — CID 69064975
N-[6-(2,5-dimethoxyphenyl)-1H-indazol-3-yl]-3-fluorobenzamide (PubChem CID 69064975) has the molecular formula C22H18FN3O3 and a molecular weight of 391.40 g/mol. Its IUPAC name is N-[6-(2,5-dimethoxyphenyl)-1H-indazol-3-yl]-3-fluorobenzamide.
| Compound Name | N-[6-(2,5-dimethoxyphenyl)-1H-indazol-3-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 69064975 |
| Molecular Formula | C22H18FN3O3 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | N-[6-(2,5-dimethoxyphenyl)-1H-indazol-3-yl]-3-fluorobenzamide |
| SMILES | COc1ccc(OC)c(-c2ccc3c(NC(=O)c4cccc(F)c4)n[nH]c3c2)c1 |
| InChI | InChI=1S/C22H18FN3O3/c1-28-16-7-9-20(29-2)18(12-16)13-6-8-17-19(11-13)25-26-21(17)24-22(27)14-4-3-5-15(23)10-14/h3-12H,1-2H3,(H2,24,25,26,27) |
| InChIKey | XKFJQIPSZYIXMD-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |