C22H18FN3O3 — CID 69063264
N-[6-(3-fluorophenyl)-1H-indazol-3-yl]-2,4-dimethoxybenzamide (PubChem CID 69063264) has the molecular formula C22H18FN3O3 and a molecular weight of 391.40 g/mol. Its IUPAC name is N-[6-(3-fluorophenyl)-1H-indazol-3-yl]-2,4-dimethoxybenzamide.
| Compound Name | N-[6-(3-fluorophenyl)-1H-indazol-3-yl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 69063264 |
| Molecular Formula | C22H18FN3O3 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | N-[6-(3-fluorophenyl)-1H-indazol-3-yl]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2n[nH]c3cc(-c4cccc(F)c4)ccc23)c(OC)c1 |
| InChI | InChI=1S/C22H18FN3O3/c1-28-16-7-9-18(20(12-16)29-2)22(27)24-21-17-8-6-14(11-19(17)25-26-21)13-4-3-5-15(23)10-13/h3-12H,1-2H3,(H2,24,25,26,27) |
| InChIKey | DLYHZNHPQLAXQZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |