C22H25N3O3 — CID 69065277
N-[6-(2,4-dimethoxyphenyl)-1H-indazol-3-yl]cyclohexanecarboxamide (PubChem CID 69065277) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[6-(2,4-dimethoxyphenyl)-1H-indazol-3-yl]cyclohexanecarboxamide.
| Compound Name | N-[6-(2,4-dimethoxyphenyl)-1H-indazol-3-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 69065277 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[6-(2,4-dimethoxyphenyl)-1H-indazol-3-yl]cyclohexanecarboxamide |
| SMILES | COc1ccc(-c2ccc3c(NC(=O)C4CCCCC4)n[nH]c3c2)c(OC)c1 |
| InChI | InChI=1S/C22H25N3O3/c1-27-16-9-11-17(20(13-16)28-2)15-8-10-18-19(12-15)24-25-21(18)23-22(26)14-6-4-3-5-7-14/h8-14H,3-7H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | SHZRLDXLJNCIFC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |