C21H23N3O — CID 69065843
N-[6-(3-methylphenyl)-1H-indazol-3-yl]cyclohexanecarboxamide (PubChem CID 69065843) has the molecular formula C21H23N3O and a molecular weight of 333.44 g/mol. Its IUPAC name is N-[6-(3-methylphenyl)-1H-indazol-3-yl]cyclohexanecarboxamide.
| Compound Name | N-[6-(3-methylphenyl)-1H-indazol-3-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 69065843 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | N-[6-(3-methylphenyl)-1H-indazol-3-yl]cyclohexanecarboxamide |
| SMILES | Cc1cccc(-c2ccc3c(NC(=O)C4CCCCC4)n[nH]c3c2)c1 |
| InChI | InChI=1S/C21H23N3O/c1-14-6-5-9-16(12-14)17-10-11-18-19(13-17)23-24-20(18)22-21(25)15-7-3-2-4-8-15/h5-6,9-13,15H,2-4,7-8H2,1H3,(H2,22,23,24,25) |
| InChIKey | KDQFSSYARILFJJ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |