C20H21N3OS — CID 69062286
N-[6-(4-ethylsulfanylphenyl)-1H-indazol-3-yl]cyclobutanecarboxamide (PubChem CID 69062286) has the molecular formula C20H21N3OS and a molecular weight of 351.48 g/mol. Its IUPAC name is N-[6-(4-ethylsulfanylphenyl)-1H-indazol-3-yl]cyclobutanecarboxamide.
| Compound Name | N-[6-(4-ethylsulfanylphenyl)-1H-indazol-3-yl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 69062286 |
| Molecular Formula | C20H21N3OS |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-[6-(4-ethylsulfanylphenyl)-1H-indazol-3-yl]cyclobutanecarboxamide |
| SMILES | CCSc1ccc(-c2ccc3c(NC(=O)C4CCC4)n[nH]c3c2)cc1 |
| InChI | InChI=1S/C20H21N3OS/c1-2-25-16-9-6-13(7-10-16)15-8-11-17-18(12-15)22-23-19(17)21-20(24)14-4-3-5-14/h6-12,14H,2-5H2,1H3,(H2,21,22,23,24) |
| InChIKey | RGYNQRSQTJMFSE-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |