C22H17F2N3O3 — CID 69060405
N-[6-(2,4-dimethoxyphenyl)-1H-indazol-3-yl]-2,4-difluorobenzamide (PubChem CID 69060405) has the molecular formula C22H17F2N3O3 and a molecular weight of 409.39 g/mol. Its IUPAC name is N-[6-(2,4-dimethoxyphenyl)-1H-indazol-3-yl]-2,4-difluorobenzamide.
| Compound Name | N-[6-(2,4-dimethoxyphenyl)-1H-indazol-3-yl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 69060405 |
| Molecular Formula | C22H17F2N3O3 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N-[6-(2,4-dimethoxyphenyl)-1H-indazol-3-yl]-2,4-difluorobenzamide |
| SMILES | COc1ccc(-c2ccc3c(NC(=O)c4ccc(F)cc4F)n[nH]c3c2)c(OC)c1 |
| InChI | InChI=1S/C22H17F2N3O3/c1-29-14-5-8-15(20(11-14)30-2)12-3-6-17-19(9-12)26-27-21(17)25-22(28)16-7-4-13(23)10-18(16)24/h3-11H,1-2H3,(H2,25,26,27,28) |
| InChIKey | LONHFILKOQVYKC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |