C21H15F2N3O2 — CID 69065723
2,4-difluoro-N-[6-(3-methoxyphenyl)-1H-indazol-3-yl]benzamide (PubChem CID 69065723) has the molecular formula C21H15F2N3O2 and a molecular weight of 379.37 g/mol. Its IUPAC name is 2,4-difluoro-N-[6-(3-methoxyphenyl)-1H-indazol-3-yl]benzamide.
| Compound Name | 2,4-difluoro-N-[6-(3-methoxyphenyl)-1H-indazol-3-yl]benzamide |
|---|---|
| PubChem CID | 69065723 |
| Molecular Formula | C21H15F2N3O2 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 2,4-difluoro-N-[6-(3-methoxyphenyl)-1H-indazol-3-yl]benzamide |
| SMILES | COc1cccc(-c2ccc3c(NC(=O)c4ccc(F)cc4F)n[nH]c3c2)c1 |
| InChI | InChI=1S/C21H15F2N3O2/c1-28-15-4-2-3-12(9-15)13-5-7-17-19(10-13)25-26-20(17)24-21(27)16-8-6-14(22)11-18(16)23/h2-11H,1H3,(H2,24,25,26,27) |
| InChIKey | GUBVUOSOZMAXRD-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |