C23H21N3O2 — CID 69060718
N-[6-(3,4-dimethylphenyl)-1H-indazol-3-yl]-2-methoxybenzamide (PubChem CID 69060718) has the molecular formula C23H21N3O2 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[6-(3,4-dimethylphenyl)-1H-indazol-3-yl]-2-methoxybenzamide.
| Compound Name | N-[6-(3,4-dimethylphenyl)-1H-indazol-3-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 69060718 |
| Molecular Formula | C23H21N3O2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | N-[6-(3,4-dimethylphenyl)-1H-indazol-3-yl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1n[nH]c2cc(-c3ccc(C)c(C)c3)ccc12 |
| InChI | InChI=1S/C23H21N3O2/c1-14-8-9-16(12-15(14)2)17-10-11-18-20(13-17)25-26-22(18)24-23(27)19-6-4-5-7-21(19)28-3/h4-13H,1-3H3,(H2,24,25,26,27) |
| InChIKey | OPOANRHCLAAXLC-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |