C24H21ClN4O4 — CID 162674383
2-[(2-chloroacetyl)amino]-N-[6-(3,5-dimethoxyphenyl)-1H-indazol-3-yl]benzamide (PubChem CID 162674383) has the molecular formula C24H21ClN4O4 and a molecular weight of 464.91 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)amino]-N-[6-(3,5-dimethoxyphenyl)-1H-indazol-3-yl]benzamide.
| Compound Name | 2-[(2-chloroacetyl)amino]-N-[6-(3,5-dimethoxyphenyl)-1H-indazol-3-yl]benzamide |
|---|---|
| PubChem CID | 162674383 |
| Molecular Formula | C24H21ClN4O4 |
| Molecular Weight | 464.91 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 2-[(2-chloroacetyl)amino]-N-[6-(3,5-dimethoxyphenyl)-1H-indazol-3-yl]benzamide |
| SMILES | COc1cc(OC)cc(-c2ccc3c(NC(=O)c4ccccc4NC(=O)CCl)n[nH]c3c2)c1 |
| InChI | InChI=1S/C24H21ClN4O4/c1-32-16-9-15(10-17(12-16)33-2)14-7-8-18-21(11-14)28-29-23(18)27-24(31)19-5-3-4-6-20(19)26-22(30)13-25/h3-12H,13H2,1-2H3,(H,26,30)(H2,27,28,29,31) |
| InChIKey | ZZJNMQJIPVWQJB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.91 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|