C21H22N6O2 — CID 69062294
1-(3-imidazol-1-ylpropyl)-3-[6-(3-methoxyphenyl)-1H-indazol-3-yl]urea (PubChem CID 69062294) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylpropyl)-3-[6-(3-methoxyphenyl)-1H-indazol-3-yl]urea.
| Compound Name | 1-(3-imidazol-1-ylpropyl)-3-[6-(3-methoxyphenyl)-1H-indazol-3-yl]urea |
|---|---|
| PubChem CID | 69062294 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 1-(3-imidazol-1-ylpropyl)-3-[6-(3-methoxyphenyl)-1H-indazol-3-yl]urea |
| SMILES | COc1cccc(-c2ccc3c(NC(=O)NCCCn4ccnc4)n[nH]c3c2)c1 |
| InChI | InChI=1S/C21H22N6O2/c1-29-17-5-2-4-15(12-17)16-6-7-18-19(13-16)25-26-20(18)24-21(28)23-8-3-10-27-11-9-22-14-27/h2,4-7,9,11-14H,3,8,10H2,1H3,(H3,23,24,25,26,28) |
| InChIKey | OAEQYAXXHGQXHP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|