C18H20N4O2 — CID 69064539
1-(3-hydroxypropyl)-3-[6-(4-methylphenyl)-1H-indazol-3-yl]urea (PubChem CID 69064539) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-3-[6-(4-methylphenyl)-1H-indazol-3-yl]urea.
| Compound Name | 1-(3-hydroxypropyl)-3-[6-(4-methylphenyl)-1H-indazol-3-yl]urea |
|---|---|
| PubChem CID | 69064539 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1-(3-hydroxypropyl)-3-[6-(4-methylphenyl)-1H-indazol-3-yl]urea |
| SMILES | Cc1ccc(-c2ccc3c(NC(=O)NCCCO)n[nH]c3c2)cc1 |
| InChI | InChI=1S/C18H20N4O2/c1-12-3-5-13(6-4-12)14-7-8-15-16(11-14)21-22-17(15)20-18(24)19-9-2-10-23/h3-8,11,23H,2,9-10H2,1H3,(H3,19,20,21,22,24) |
| InChIKey | LUUSFRZUNSXVAC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|